About 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane
5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane (PubChem CID 106177888) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane |
| PubChem CID | 106177888 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane |
| SMILES | CCc1ccc(C2OCCC(C)(CC)NC2C)cc1 |
| InChI | InChI=1S/C17H27NO/c1-5-14-7-9-15(10-8-14)16-13(3)18-17(4,6-2)11-12-19-16/h7-10,13,16,18H,5-6,11-12H2,1-4H3 |
| InChIKey | SXZSMTSUNOSULJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane?
The IUPAC name of 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane (CID 106177888) is 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane.
What is the SMILES notation for 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane?
The canonical SMILES for 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane is CCc1ccc(C2OCCC(C)(CC)NC2C)cc1.
What is the InChIKey of 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane?
The InChIKey is SXZSMTSUNOSULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO/c1-5-14-7-9-15(10-8-14)16-13(3)18-17(4,6-2)11-12-19-16/h7-10,13,16,18H,5-6,11-12H2,1-4H3.
What are the key properties of 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane?
5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane has a molecular weight of 261.41 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-(4-ethylphenyl)-3,5-dimethyl-1,4-oxazepane is sourced from PubChem (CID 106177888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).