About 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one
4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 106177936) has the molecular formula C9H12BrF2N3O3
and a molecular weight of 328.11 g/mol. Its IUPAC name is 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one |
| PubChem CID | 106177936 |
| Molecular Formula | C9H12BrF2N3O3 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCC(F)(F)CO)cnn1CCO |
| InChI | InChI=1S/C9H12BrF2N3O3/c10-7-6(13-4-9(11,12)5-17)3-14-15(1-2-16)8(7)18/h3,13,16-17H,1-2,4-5H2 |
| InChIKey | PIWYSRKWYUTJEF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one?
The IUPAC name of 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one (CID 106177936) is 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one.
What is the SMILES notation for 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one?
The canonical SMILES for 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one is O=c1c(Br)c(NCC(F)(F)CO)cnn1CCO.
What is the InChIKey of 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one?
The InChIKey is PIWYSRKWYUTJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrF2N3O3/c10-7-6(13-4-9(11,12)5-17)3-14-15(1-2-16)8(7)18/h3,13,16-17H,1-2,4-5H2.
What are the key properties of 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one?
4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one has a molecular weight of 328.11 g/mol, XLogP of 0.04, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-[(2,2-difluoro-3-hydroxypropyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one is sourced from PubChem (CID 106177936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).