About 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid
4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid (PubChem CID 106178188) has the molecular formula C9H11F2N3O3
and a molecular weight of 247.20 g/mol. Its IUPAC name is 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid |
| PubChem CID | 106178188 |
| Molecular Formula | C9H11F2N3O3 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1CNCC(F)(F)CO |
| InChI | InChI=1S/C9H11F2N3O3/c10-9(11,4-15)3-12-2-7-6(8(16)17)1-13-5-14-7/h1,5,12,15H,2-4H2,(H,16,17) |
| InChIKey | UNJFQWVEGSILDL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid?
The IUPAC name of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid (CID 106178188) is 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid?
The canonical SMILES for 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid is O=C(O)c1cncnc1CNCC(F)(F)CO.
What is the InChIKey of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid?
The InChIKey is UNJFQWVEGSILDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N3O3/c10-9(11,4-15)3-12-2-7-6(8(16)17)1-13-5-14-7/h1,5,12,15H,2-4H2,(H,16,17).
What are the key properties of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid?
4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid has a molecular weight of 247.20 g/mol, XLogP of -0.11, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrimidine-5-carboxylic acid is sourced from PubChem (CID 106178188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).