About 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid
4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid (PubChem CID 106178193) has the molecular formula C9H15F2NO3
and a molecular weight of 223.22 g/mol. Its IUPAC name is 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid.
Molecular Properties
| Compound Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid |
| PubChem CID | 106178193 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCNCC(F)(F)CO)C(=O)O |
| InChI | InChI=1S/C9H15F2NO3/c1-2-7(8(14)15)3-4-12-5-9(10,11)6-13/h3,12-13H,2,4-6H2,1H3,(H,14,15) |
| InChIKey | OJNSBBFVSBFIMQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid?
The IUPAC name of 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid (CID 106178193) is 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid.
What is the SMILES notation for 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid?
The canonical SMILES for 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid is CCC(=CCNCC(F)(F)CO)C(=O)O.
What is the InChIKey of 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid?
The InChIKey is OJNSBBFVSBFIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO3/c1-2-7(8(14)15)3-4-12-5-9(10,11)6-13/h3,12-13H,2,4-6H2,1H3,(H,14,15).
What are the key properties of 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid?
4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid has a molecular weight of 223.22 g/mol, XLogP of 0.62, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-difluoro-3-hydroxypropyl)amino]-2-ethylbut-2-enoic acid is sourced from PubChem (CID 106178193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).