About 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid
4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106178227) has the molecular formula C11H19F2NO4
and a molecular weight of 267.27 g/mol. Its IUPAC name is 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid |
| PubChem CID | 106178227 |
| Molecular Formula | C11H19F2NO4 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)(CNCC(F)(F)CO)CC1 |
| InChI | InChI=1S/C11H19F2NO4/c12-11(13,7-15)6-14-5-10(18)3-1-8(2-4-10)9(16)17/h8,14-15,18H,1-7H2,(H,16,17) |
| InChIKey | XLCIGAQDBFODCR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid?
The IUPAC name of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid (CID 106178227) is 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid is O=C(O)C1CCC(O)(CNCC(F)(F)CO)CC1.
What is the InChIKey of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid?
The InChIKey is XLCIGAQDBFODCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO4/c12-11(13,7-15)6-14-5-10(18)3-1-8(2-4-10)9(16)17/h8,14-15,18H,1-7H2,(H,16,17).
What are the key properties of 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid?
4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid has a molecular weight of 267.27 g/mol, XLogP of 0.21, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylic acid is sourced from PubChem (CID 106178227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).