C12H15F2NO4 — CID 106178233
2-[2-[(2,2-difluoro-3-hydroxypropyl)amino]ethoxy]benzoic acid (PubChem CID 106178233) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[2-[(2,2-difluoro-3-hydroxypropyl)amino]ethoxy]benzoic acid.
| Compound Name | 2-[2-[(2,2-difluoro-3-hydroxypropyl)amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 106178233 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[2-[(2,2-difluoro-3-hydroxypropyl)amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OCCNCC(F)(F)CO |
| InChI | InChI=1S/C12H15F2NO4/c13-12(14,8-16)7-15-5-6-19-10-4-2-1-3-9(10)11(17)18/h1-4,15-16H,5-8H2,(H,17,18) |
| InChIKey | SOUWBQDJEFBCNY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|