C13H17N3O3S — CID 106178511
2-[[2-(cyclopenten-1-yl)ethylcarbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 106178511) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[[2-(cyclopenten-1-yl)ethylcarbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[2-(cyclopenten-1-yl)ethylcarbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106178511 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[[2-(cyclopenten-1-yl)ethylcarbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCC1=CCCC1)NCc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H17N3O3S/c17-12(18)10-8-20-11(16-10)7-15-13(19)14-6-5-9-3-1-2-4-9/h3,8H,1-2,4-7H2,(H,17,18)(H2,14,15,19) |
| InChIKey | DILQPZUSTNOVEZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|