C22H38O3 — CID 10617871
(3S,4S)-3-hexyl-4-[(2R,4Z,7Z)-2-hydroxytrideca-4,7-dienyl]oxetan-2-one (PubChem CID 10617871) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (3S,4S)-3-hexyl-4-[(2R,4Z,7Z)-2-hydroxytrideca-4,7-dienyl]oxetan-2-one.
| Compound Name | (3S,4S)-3-hexyl-4-[(2R,4Z,7Z)-2-hydroxytrideca-4,7-dienyl]oxetan-2-one |
|---|---|
| PubChem CID | 10617871 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (3S,4S)-3-hexyl-4-[(2R,4Z,7Z)-2-hydroxytrideca-4,7-dienyl]oxetan-2-one |
| SMILES | CCCCC/C=C\C/C=C\C[C@@H](O)C[C@@H]1OC(=O)[C@H]1CCCCCC |
| InChI | InChI=1S/C22H38O3/c1-3-5-7-9-10-11-12-13-14-16-19(23)18-21-20(22(24)25-21)17-15-8-6-4-2/h10-11,13-14,19-21,23H,3-9,12,15-18H2,1-2H3/b11-10-,14-13-/t19-,20+,21+/m1/s1 |
| InChIKey | AAWOMKPGDBROBM-BFVUZVSOSA-N |
| XLogP | 5.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|