About 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol
3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 106179297) has the molecular formula C9H14F2N4O
and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 106179297 |
| Molecular Formula | C9H14F2N4O |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | CCc1c(N)ncnc1NCC(F)(F)CO |
| InChI | InChI=1S/C9H14F2N4O/c1-2-6-7(12)14-5-15-8(6)13-3-9(10,11)4-16/h5,16H,2-4H2,1H3,(H3,12,13,14,15) |
| InChIKey | MPLLQCRLNDWURP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol (CID 106179297) is 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol is CCc1c(N)ncnc1NCC(F)(F)CO.
What is the InChIKey of 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
The InChIKey is MPLLQCRLNDWURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N4O/c1-2-6-7(12)14-5-15-8(6)13-3-9(10,11)4-16/h5,16H,2-4H2,1H3,(H3,12,13,14,15).
What are the key properties of 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol has a molecular weight of 232.23 g/mol, XLogP of 0.66, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106179297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).