About 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol
3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol (PubChem CID 106179301) has the molecular formula C12H20F2N4O
and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 106179301 |
| Molecular Formula | C12H20F2N4O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol |
| SMILES | CCCNc1ncnc(NCC(F)(F)CO)c1CC |
| InChI | InChI=1S/C12H20F2N4O/c1-3-5-15-10-9(4-2)11(18-8-17-10)16-6-12(13,14)7-19/h8,19H,3-7H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | COHIJPWRINYEKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol (CID 106179301) is 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol is CCCNc1ncnc(NCC(F)(F)CO)c1CC.
What is the InChIKey of 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol?
The InChIKey is COHIJPWRINYEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N4O/c1-3-5-15-10-9(4-2)11(18-8-17-10)16-6-12(13,14)7-19/h8,19H,3-7H2,1-2H3,(H2,15,16,17,18).
What are the key properties of 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol?
3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol has a molecular weight of 274.31 g/mol, XLogP of 1.90, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-ethyl-6-(propylamino)pyrimidin-4-yl]amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106179301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).