C16H22N3OSe — CID 10617961
CID 10617961 (PubChem CID 10617961) has the molecular formula C16H22N3OSe and a molecular weight of 351.33 g/mol.
| Compound Name | CID 10617961 |
|---|---|
| PubChem CID | 10617961 |
| Molecular Formula | C16H22N3OSe |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | — |
| SMILES | CCN(CC)CCNC(=O)c1c([Se])n(C)c2ccccc12 |
| InChI | InChI=1S/C16H22N3OSe/c1-4-19(5-2)11-10-17-15(20)14-12-8-6-7-9-13(12)18(3)16(14)21/h6-9H,4-5,10-11H2,1-3H3,(H,17,20) |
| InChIKey | PIPUESMLQLTMOE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|