C15H20BrNO — CID 106180258
8-bromo-N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 106180258) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is 8-bromo-N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | 8-bromo-N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 106180258 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 8-bromo-N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | CC(C)=CCNC1CCCOc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H20BrNO/c1-11(2)7-8-17-14-4-3-9-18-15-10-12(16)5-6-13(14)15/h5-7,10,14,17H,3-4,8-9H2,1-2H3 |
| InChIKey | YJITZBXNZUXOTQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|