C18H25BrO2 — CID 10618033
5-bromo-4-methoxy-2-[[(1S,4R)-2,2,4-trimethyl-6-methylidenecyclohexyl]methyl]phenol (PubChem CID 10618033) has the molecular formula C18H25BrO2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-bromo-4-methoxy-2-[[(1S,4R)-2,2,4-trimethyl-6-methylidenecyclohexyl]methyl]phenol.
| Compound Name | 5-bromo-4-methoxy-2-[[(1S,4R)-2,2,4-trimethyl-6-methylidenecyclohexyl]methyl]phenol |
|---|---|
| PubChem CID | 10618033 |
| Molecular Formula | C18H25BrO2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 5-bromo-4-methoxy-2-[[(1S,4R)-2,2,4-trimethyl-6-methylidenecyclohexyl]methyl]phenol |
| SMILES | C=C1C[C@H](C)CC(C)(C)[C@@H]1Cc1cc(OC)c(Br)cc1O |
| InChI | InChI=1S/C18H25BrO2/c1-11-6-12(2)14(18(3,4)10-11)7-13-8-17(21-5)15(19)9-16(13)20/h8-9,11,14,20H,2,6-7,10H2,1,3-5H3/t11-,14+/m0/s1 |
| InChIKey | LMHUNJRFYIMKDB-SMDDNHRTSA-N |
| XLogP | 5.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|