C11H24N2O — CID 106180602
5-methoxy-4-N-(3-methylbut-2-enyl)pentane-1,4-diamine (PubChem CID 106180602) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 5-methoxy-4-N-(3-methylbut-2-enyl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(3-methylbut-2-enyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 106180602 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 5-methoxy-4-N-(3-methylbut-2-enyl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)NCC=C(C)C |
| InChI | InChI=1S/C11H24N2O/c1-10(2)6-8-13-11(9-14-3)5-4-7-12/h6,11,13H,4-5,7-9,12H2,1-3H3 |
| InChIKey | SOXHSGAJWCPDPN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|