C21H23NO4 — CID 10618061
(4aR,7S,7aS,8R)-6-benzyl-5-oxo-7-propan-2-yl-4a,7,7a,8-tetrahydro-4H-furo[2,3-f]isoindole-8-carboxylic acid (PubChem CID 10618061) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4aR,7S,7aS,8R)-6-benzyl-5-oxo-7-propan-2-yl-4a,7,7a,8-tetrahydro-4H-furo[2,3-f]isoindole-8-carboxylic acid.
| Compound Name | (4aR,7S,7aS,8R)-6-benzyl-5-oxo-7-propan-2-yl-4a,7,7a,8-tetrahydro-4H-furo[2,3-f]isoindole-8-carboxylic acid |
|---|---|
| PubChem CID | 10618061 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (4aR,7S,7aS,8R)-6-benzyl-5-oxo-7-propan-2-yl-4a,7,7a,8-tetrahydro-4H-furo[2,3-f]isoindole-8-carboxylic acid |
| SMILES | CC(C)[C@H]1[C@H]2[C@@H](Cc3ccoc3[C@@H]2C(=O)O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-12(2)18-16-15(10-14-8-9-26-19(14)17(16)21(24)25)20(23)22(18)11-13-6-4-3-5-7-13/h3-9,12,15-18H,10-11H2,1-2H3,(H,24,25)/t15-,16+,17-,18+/m1/s1 |
| InChIKey | HPKZIQDIJYFGKO-XDNAFOTISA-N |
| XLogP | 3.30 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |