C17H27NO3SSi — CID 10618079
(5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-yl-3-trimethylsilylpyrrolidin-2-one (PubChem CID 10618079) has the molecular formula C17H27NO3SSi and a molecular weight of 353.56 g/mol. Its IUPAC name is (5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-yl-3-trimethylsilylpyrrolidin-2-one.
| Compound Name | (5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-yl-3-trimethylsilylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10618079 |
| Molecular Formula | C17H27NO3SSi |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-yl-3-trimethylsilylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C([Si](C)(C)C)C[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C17H27NO3SSi/c1-12(2)15-11-16(23(4,5)6)17(19)18(15)22(20,21)14-9-7-13(3)8-10-14/h7-10,12,15-16H,11H2,1-6H3/t15-,16?/m1/s1 |
| InChIKey | DDXXZTCUNJQASA-AAFJCEBUSA-N |
| XLogP | 3.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|