C12H16ClN3OS — CID 106181337
N-(1-chloro-3-methoxypropan-2-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 106181337) has the molecular formula C12H16ClN3OS and a molecular weight of 285.80 g/mol. Its IUPAC name is N-(1-chloro-3-methoxypropan-2-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1-chloro-3-methoxypropan-2-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106181337 |
| Molecular Formula | C12H16ClN3OS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(1-chloro-3-methoxypropan-2-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCC(CCl)Nc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C12H16ClN3OS/c1-7-8(2)18-12-10(7)11(14-6-15-12)16-9(4-13)5-17-3/h6,9H,4-5H2,1-3H3,(H,14,15,16) |
| InChIKey | IMOGMNCQLYWJRC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|