C12H18ClFN2O3S — CID 106181468
5-amino-2-chloro-4-fluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzenesulfonamide (PubChem CID 106181468) has the molecular formula C12H18ClFN2O3S and a molecular weight of 324.81 g/mol. Its IUPAC name is 5-amino-2-chloro-4-fluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-4-fluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106181468 |
| Molecular Formula | C12H18ClFN2O3S |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-amino-2-chloro-4-fluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(O)C(C)(C)NS(=O)(=O)c1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C12H18ClFN2O3S/c1-11(2,12(3,4)17)16-20(18,19)10-6-9(15)8(14)5-7(10)13/h5-6,16-17H,15H2,1-4H3 |
| InChIKey | FTGVVQCYLIEIEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|