C14H17FN2O — CID 106181804
4-[[3-(4-fluorophenyl)cyclobutyl]amino]pyrrolidin-2-one (PubChem CID 106181804) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-[[3-(4-fluorophenyl)cyclobutyl]amino]pyrrolidin-2-one.
| Compound Name | 4-[[3-(4-fluorophenyl)cyclobutyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106181804 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-[[3-(4-fluorophenyl)cyclobutyl]amino]pyrrolidin-2-one |
| SMILES | O=C1CC(NC2CC(c3ccc(F)cc3)C2)CN1 |
| InChI | InChI=1S/C14H17FN2O/c15-11-3-1-9(2-4-11)10-5-12(6-10)17-13-7-14(18)16-8-13/h1-4,10,12-13,17H,5-8H2,(H,16,18) |
| InChIKey | IOQKDARKQIFNAR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |