C13H18N2O — CID 106183258
4-[(3,5-dimethylphenyl)methylamino]pyrrolidin-2-one (PubChem CID 106183258) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)methylamino]pyrrolidin-2-one.
| Compound Name | 4-[(3,5-dimethylphenyl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106183258 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)methylamino]pyrrolidin-2-one |
| SMILES | Cc1cc(C)cc(CNC2CNC(=O)C2)c1 |
| InChI | InChI=1S/C13H18N2O/c1-9-3-10(2)5-11(4-9)7-14-12-6-13(16)15-8-12/h3-5,12,14H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | XZXWJAANKBTGJA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |