C11H11F2N3O3 — CID 106183585
4-[(2,4-difluoro-5-nitrophenyl)methylamino]pyrrolidin-2-one (PubChem CID 106183585) has the molecular formula C11H11F2N3O3 and a molecular weight of 271.22 g/mol. Its IUPAC name is 4-[(2,4-difluoro-5-nitrophenyl)methylamino]pyrrolidin-2-one.
| Compound Name | 4-[(2,4-difluoro-5-nitrophenyl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106183585 |
| Molecular Formula | C11H11F2N3O3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[(2,4-difluoro-5-nitrophenyl)methylamino]pyrrolidin-2-one |
| SMILES | O=C1CC(NCc2cc([N+](=O)[O-])c(F)cc2F)CN1 |
| InChI | InChI=1S/C11H11F2N3O3/c12-8-3-9(13)10(16(18)19)1-6(8)4-14-7-2-11(17)15-5-7/h1,3,7,14H,2,4-5H2,(H,15,17) |
| InChIKey | AVOFHBFDNGOLPH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|