C12H21N3O3 — CID 106184001
2-[(5-amino-6-propan-2-yloxy-2-pyridinyl)amino]-3-methoxypropan-1-ol (PubChem CID 106184001) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(5-amino-6-propan-2-yloxy-2-pyridinyl)amino]-3-methoxypropan-1-ol.
| Compound Name | 2-[(5-amino-6-propan-2-yloxy-2-pyridinyl)amino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106184001 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[(5-amino-6-propan-2-yloxy-2-pyridinyl)amino]-3-methoxypropan-1-ol |
| SMILES | COCC(CO)Nc1ccc(N)c(OC(C)C)n1 |
| InChI | InChI=1S/C12H21N3O3/c1-8(2)18-12-10(13)4-5-11(15-12)14-9(6-16)7-17-3/h4-5,8-9,16H,6-7,13H2,1-3H3,(H,14,15) |
| InChIKey | GBWOBQAINXBIOG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |