About 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one
4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one (PubChem CID 106184016) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one |
| PubChem CID | 106184016 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one |
| SMILES | CC1CC(C)(C)CC1NC1CNC(=O)C1 |
| InChI | InChI=1S/C12H22N2O/c1-8-5-12(2,3)6-10(8)14-9-4-11(15)13-7-9/h8-10,14H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | XRPGYMSWADQCHE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one?
The IUPAC name of 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one (CID 106184016) is 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one.
What is the SMILES notation for 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one?
The canonical SMILES for 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one is CC1CC(C)(C)CC1NC1CNC(=O)C1.
What is the InChIKey of 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one?
The InChIKey is XRPGYMSWADQCHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-8-5-12(2,3)6-10(8)14-9-4-11(15)13-7-9/h8-10,14H,4-7H2,1-3H3,(H,13,15).
What are the key properties of 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one?
4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one has a molecular weight of 210.32 g/mol, XLogP of 1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4,4-trimethylcyclopentyl)amino]pyrrolidin-2-one is sourced from PubChem (CID 106184016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).