C10H16ClN3O — CID 106185543
3-[(6-chloropyridazin-3-yl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 106185543) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-[(6-chloropyridazin-3-yl)amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(6-chloropyridazin-3-yl)amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106185543 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-[(6-chloropyridazin-3-yl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C10H16ClN3O/c1-9(2,10(3,4)15)12-8-6-5-7(11)13-14-8/h5-6,15H,1-4H3,(H,12,14) |
| InChIKey | MVCJADSEYMKEME-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |