About 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol
3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol (PubChem CID 106185784) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol |
| PubChem CID | 106185784 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)CNC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C11H25NO/c1-9(2,3)8-12-10(4,5)11(6,7)13/h12-13H,8H2,1-7H3 |
| InChIKey | CZBJQFXMARTIQY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol?
The IUPAC name of 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol (CID 106185784) is 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol?
The canonical SMILES for 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol is CC(C)(C)CNC(C)(C)C(C)(C)O.
What is the InChIKey of 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol?
The InChIKey is CZBJQFXMARTIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO/c1-9(2,3)8-12-10(4,5)11(6,7)13/h12-13H,8H2,1-7H3.
What are the key properties of 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol?
3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol has a molecular weight of 187.33 g/mol, XLogP of 2.17, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropylamino)-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 106185784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).