C18H27NO6 — CID 10618600
(1R,4Z,6R,7R,11S,12S,17R)-6-deuterio-7,12-dihydroxy-7-methyl-4-(1,2,2,2-tetradeuterioethylidene)-6-(trideuteriomethyl)-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione (PubChem CID 10618600) has the molecular formula C18H27NO6 and a molecular weight of 361.46 g/mol. Its IUPAC name is (1R,4Z,6R,7R,11S,12S,17R)-6-deuterio-7,12-dihydroxy-7-methyl-4-(1,2,2,2-tetradeuterioethylidene)-6-(trideuteriomethyl)-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione.
| Compound Name | (1R,4Z,6R,7R,11S,12S,17R)-6-deuterio-7,12-dihydroxy-7-methyl-4-(1,2,2,2-tetradeuterioethylidene)-6-(trideuteriomethyl)-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione |
|---|---|
| PubChem CID | 10618600 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (1R,4Z,6R,7R,11S,12S,17R)-6-deuterio-7,12-dihydroxy-7-methyl-4-(1,2,2,2-tetradeuterioethylidene)-6-(trideuteriomethyl)-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione |
| SMILES | [2H]/C(=C1\C[C@@]([2H])(C([2H])([2H])[2H])[C@@](C)(O)C(=O)OC[C@@H]2[C@@H]3[C@@H](CCN3C[C@H]2O)OC1=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C18H27NO6/c1-4-11-7-10(2)18(3,23)17(22)24-9-12-13(20)8-19-6-5-14(15(12)19)25-16(11)21/h4,10,12-15,20,23H,5-9H2,1-3H3/b11-4-/t10-,12+,13-,14-,15-,18-/m1/s1/i1D3,2D3,4D,10D |
| InChIKey | YEXVXKIMPBHRQR-FQLXMLJPSA-N |
| XLogP | 0.24 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|