About 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol
2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol (PubChem CID 106186000) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol.
Molecular Properties
| Compound Name | 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol |
| PubChem CID | 106186000 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1nccn2nccc12 |
| InChI | InChI=1S/C12H18N4O/c1-11(2,12(3,4)17)15-10-9-5-6-14-16(9)8-7-13-10/h5-8,17H,1-4H3,(H,13,15) |
| InChIKey | LIHJQMVXTFSWDR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol?
The IUPAC name of 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol (CID 106186000) is 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol.
What is the SMILES notation for 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol?
The canonical SMILES for 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol is CC(C)(O)C(C)(C)Nc1nccn2nccc12.
What is the InChIKey of 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol?
The InChIKey is LIHJQMVXTFSWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O/c1-11(2,12(3,4)17)15-10-9-5-6-14-16(9)8-7-13-10/h5-8,17H,1-4H3,(H,13,15).
What are the key properties of 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol?
2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol has a molecular weight of 234.30 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-2-ol is sourced from PubChem (CID 106186000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).