About 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide
2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide (PubChem CID 106186134) has the molecular formula C10H20BrNO2
and a molecular weight of 266.18 g/mol. Its IUPAC name is 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide |
| PubChem CID | 106186134 |
| Molecular Formula | C10H20BrNO2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C10H20BrNO2/c1-8(2,11)7(13)12-9(3,4)10(5,6)14/h14H,1-6H3,(H,12,13) |
| InChIKey | OLVVYYVADZHZMP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide?
The IUPAC name of 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide (CID 106186134) is 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide.
What is the SMILES notation for 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide?
The canonical SMILES for 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide is CC(C)(Br)C(=O)NC(C)(C)C(C)(C)O.
What is the InChIKey of 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide?
The InChIKey is OLVVYYVADZHZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO2/c1-8(2,11)7(13)12-9(3,4)10(5,6)14/h14H,1-6H3,(H,12,13).
What are the key properties of 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide?
2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide has a molecular weight of 266.18 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylpropanamide is sourced from PubChem (CID 106186134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).