About 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol
3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol (PubChem CID 106186629) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol |
| PubChem CID | 106186629 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol |
| SMILES | CC1(C)CN(C(C)(C)C(C)(C)O)C1 |
| InChI | InChI=1S/C11H23NO/c1-9(2)7-12(8-9)10(3,4)11(5,6)13/h13H,7-8H2,1-6H3 |
| InChIKey | UGUSJSFPCIFERD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol?
The IUPAC name of 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol (CID 106186629) is 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol?
The canonical SMILES for 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol is CC1(C)CN(C(C)(C)C(C)(C)O)C1.
What is the InChIKey of 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol?
The InChIKey is UGUSJSFPCIFERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-9(2)7-12(8-9)10(3,4)11(5,6)13/h13H,7-8H2,1-6H3.
What are the key properties of 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol?
3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol has a molecular weight of 185.31 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylazetidin-1-yl)-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 106186629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).