C18H24N2O4S — CID 10618773
(4-methoxyphenyl)methyl (2S,4S)-2-[(2-oxopyrrolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 10618773) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-[(2-oxopyrrolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(2-oxopyrrolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10618773 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(2-oxopyrrolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2C[C@@H](S)C[C@H]2CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-23-15-6-4-13(5-7-15)12-24-18(22)20-11-16(25)9-14(20)10-19-8-2-3-17(19)21/h4-7,14,16,25H,2-3,8-12H2,1H3/t14-,16-/m0/s1 |
| InChIKey | SXQUAIXNNUPUDS-HOCLYGCPSA-N |
| XLogP | 2.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|