About dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate
dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate (PubChem CID 10618775) has the molecular formula C18H24O6Si
and a molecular weight of 364.47 g/mol. Its IUPAC name is dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate |
| PubChem CID | 10618775 |
| Molecular Formula | C18H24O6Si |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate |
| SMILES | COC(=O)c1cc(O[Si](C)(C)C(C)(C)C)c2ccoc2c1C(=O)OC |
| InChI | InChI=1S/C18H24O6Si/c1-18(2,3)25(6,7)24-13-10-12(16(19)21-4)14(17(20)22-5)15-11(13)8-9-23-15/h8-10H,1-7H3 |
| InChIKey | LEBGEKRRIHFUQC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate?
The IUPAC name of dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate (CID 10618775) is dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate.
What is the SMILES notation for dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate?
The canonical SMILES for dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate is COC(=O)c1cc(O[Si](C)(C)C(C)(C)C)c2ccoc2c1C(=O)OC.
What is the InChIKey of dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate?
The InChIKey is LEBGEKRRIHFUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O6Si/c1-18(2,3)25(6,7)24-13-10-12(16(19)21-4)14(17(20)22-5)15-11(13)8-9-23-15/h8-10H,1-7H3.
What are the key properties of dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate?
dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate has a molecular weight of 364.47 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-6,7-dicarboxylate is sourced from PubChem (CID 10618775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).