C24H32N2O — CID 10618791
(1R,9S,13S)-10-[2-(N-ethylanilino)ethyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 10618791) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (1R,9S,13S)-10-[2-(N-ethylanilino)ethyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9S,13S)-10-[2-(N-ethylanilino)ethyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 10618791 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (1R,9S,13S)-10-[2-(N-ethylanilino)ethyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CCN(CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@H]1[C@H]2C)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O/c1-4-25(20-8-6-5-7-9-20)14-15-26-13-12-24(3)18(2)23(26)16-19-10-11-21(27)17-22(19)24/h5-11,17-18,23,27H,4,12-16H2,1-3H3/t18-,23+,24-/m1/s1 |
| InChIKey | XWZCZVLFGAYTMR-PUZWTLIVSA-N |
| XLogP | 4.44 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |