C11H20N2 — CID 106188472
N-(3-methylbut-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 106188472) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(3-methylbut-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 106188472 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-(3-methylbut-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | CC(C)=CCNC1=NCCCCC1 |
| InChI | InChI=1S/C11H20N2/c1-10(2)7-9-13-11-6-4-3-5-8-12-11/h7H,3-6,8-9H2,1-2H3,(H,12,13) |
| InChIKey | BGMVAPOOLFCPDH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|