C8H12N2O — CID 106189245
4-(but-3-yn-2-ylamino)pyrrolidin-2-one (PubChem CID 106189245) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-(but-3-yn-2-ylamino)pyrrolidin-2-one.
| Compound Name | 4-(but-3-yn-2-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 106189245 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 4-(but-3-yn-2-ylamino)pyrrolidin-2-one |
| SMILES | C#CC(C)NC1CNC(=O)C1 |
| InChI | InChI=1S/C8H12N2O/c1-3-6(2)10-7-4-8(11)9-5-7/h1,6-7,10H,4-5H2,2H3,(H,9,11) |
| InChIKey | HBAYKRABFJVBKT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|