C27H28O — CID 10619052
(1R,2S,3R,4R,5R,6S,7S,10R,11R,12S,13S,14S,15R,16S)-3,14-dimethylnonacyclo[14.6.1.15,12.17,10.02,15.03,14.04,13.06,11.017,22]pentacosa-8,17,19,21-tetraen-25-one (PubChem CID 10619052) has the molecular formula C27H28O and a molecular weight of 368.52 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R,6S,7S,10R,11R,12S,13S,14S,15R,16S)-3,14-dimethylnonacyclo[14.6.1.15,12.17,10.02,15.03,14.04,13.06,11.017,22]pentacosa-8,17,19,21-tetraen-25-one.
| Compound Name | (1R,2S,3R,4R,5R,6S,7S,10R,11R,12S,13S,14S,15R,16S)-3,14-dimethylnonacyclo[14.6.1.15,12.17,10.02,15.03,14.04,13.06,11.017,22]pentacosa-8,17,19,21-tetraen-25-one |
|---|---|
| PubChem CID | 10619052 |
| Molecular Formula | C27H28O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (1R,2S,3R,4R,5R,6S,7S,10R,11R,12S,13S,14S,15R,16S)-3,14-dimethylnonacyclo[14.6.1.15,12.17,10.02,15.03,14.04,13.06,11.017,22]pentacosa-8,17,19,21-tetraen-25-one |
| SMILES | C[C@@]12[C@H]3[C@H]4C[C@H]([C@H]5[C@@H]4[C@H]4C=C[C@@H]5C4=O)[C@H]3[C@]1(C)[C@@H]1[C@H]2[C@@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C27H28O/c1-26-21-15-9-16(12-6-4-3-5-11(12)15)22(21)27(26,2)24-18-10-17(23(24)26)19-13-7-8-14(20(18)19)25(13)28/h3-8,13-24H,9-10H2,1-2H3/t13-,14+,15-,16+,17+,18-,19-,20+,21-,22+,23+,24-,26-,27+ |
| InChIKey | KRHDLMHIYPNPJA-RPEOQCNKSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|