C12H17F3N2O3 — CID 106191155
1-(3-methylbut-2-enylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 106191155) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 1-(3-methylbut-2-enylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-methylbut-2-enylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106191155 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(3-methylbut-2-enylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)=CCNC(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H17F3N2O3/c1-8(2)3-5-16-10(20)17-6-4-11(7-17,9(18)19)12(13,14)15/h3H,4-7H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | CWTSORRXSFPURM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|