About phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate
phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate (PubChem CID 10619128) has the molecular formula C16H17F3N4O3
and a molecular weight of 370.33 g/mol. Its IUPAC name is phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate.
Molecular Properties
| Compound Name | phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate |
| PubChem CID | 10619128 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate |
| SMILES | CC(O)(C(=O)N1CCN(/C(=N\C#N)Oc2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O3/c1-15(25,16(17,18)19)13(24)22-7-9-23(10-8-22)14(21-11-20)26-12-5-3-2-4-6-12/h2-6,25H,7-10H2,1H3/b21-14+ |
| InChIKey | HUNACMQVVHOXOO-KGENOOAVSA-N |
| XLogP | 1.36 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate?
The IUPAC name of phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate (CID 10619128) is phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate.
What is the SMILES notation for phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate?
The canonical SMILES for phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate is CC(O)(C(=O)N1CCN(/C(=N\C#N)Oc2ccccc2)CC1)C(F)(F)F.
What is the InChIKey of phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate?
The InChIKey is HUNACMQVVHOXOO-KGENOOAVSA-N. The full InChI is InChI=1S/C16H17F3N4O3/c1-15(25,16(17,18)19)13(24)22-7-9-23(10-8-22)14(21-11-20)26-12-5-3-2-4-6-12/h2-6,25H,7-10H2,1H3/b21-14+.
What are the key properties of phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate?
phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate has a molecular weight of 370.33 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-cyano-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)piperazine-1-carboximidate is sourced from PubChem (CID 10619128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).