C9H10ClN3S — CID 106191529
4-chloro-2-(3-methylbut-2-enylamino)-1,3-thiazole-5-carbonitrile (PubChem CID 106191529) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is 4-chloro-2-(3-methylbut-2-enylamino)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-chloro-2-(3-methylbut-2-enylamino)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 106191529 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-chloro-2-(3-methylbut-2-enylamino)-1,3-thiazole-5-carbonitrile |
| SMILES | CC(C)=CCNc1nc(Cl)c(C#N)s1 |
| InChI | InChI=1S/C9H10ClN3S/c1-6(2)3-4-12-9-13-8(10)7(5-11)14-9/h3H,4H2,1-2H3,(H,12,13) |
| InChIKey | NOBWNKNGMAWKDI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|