C16H20N2O3 — CID 106191534
(3R)-2-(3-methylbut-2-enylcarbamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 106191534) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (3R)-2-(3-methylbut-2-enylcarbamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3R)-2-(3-methylbut-2-enylcarbamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 106191534 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (3R)-2-(3-methylbut-2-enylcarbamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CC(C)=CCNC(=O)N1Cc2ccccc2C[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-11(2)7-8-17-16(21)18-10-13-6-4-3-5-12(13)9-14(18)15(19)20/h3-7,14H,8-10H2,1-2H3,(H,17,21)(H,19,20)/t14-/m1/s1 |
| InChIKey | KMVZPTBPVRJASM-CQSZACIVSA-N |
| XLogP | 2.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|