About 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one
4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one (PubChem CID 106192216) has the molecular formula C9H8F3N3O
and a molecular weight of 231.18 g/mol. Its IUPAC name is 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one |
| PubChem CID | 106192216 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one |
| SMILES | O=C1CC(Nc2nc(F)c(F)cc2F)CN1 |
| InChI | InChI=1S/C9H8F3N3O/c10-5-2-6(11)9(15-8(5)12)14-4-1-7(16)13-3-4/h2,4H,1,3H2,(H,13,16)(H,14,15) |
| InChIKey | CBEZMMWUFWGVKX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one?
The IUPAC name of 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one (CID 106192216) is 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one.
What is the SMILES notation for 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one?
The canonical SMILES for 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one is O=C1CC(Nc2nc(F)c(F)cc2F)CN1.
What is the InChIKey of 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one?
The InChIKey is CBEZMMWUFWGVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3N3O/c10-5-2-6(11)9(15-8(5)12)14-4-1-7(16)13-3-4/h2,4H,1,3H2,(H,13,16)(H,14,15).
What are the key properties of 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one?
4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one has a molecular weight of 231.18 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5,6-trifluoro-2-pyridinyl)amino]pyrrolidin-2-one is sourced from PubChem (CID 106192216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).