About 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 106192316) has the molecular formula C10H15ClFN3O
and a molecular weight of 247.70 g/mol. Its IUPAC name is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol |
| PubChem CID | 106192316 |
| Molecular Formula | C10H15ClFN3O |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H15ClFN3O/c1-9(2,10(3,4)16)15-7-6(12)5-13-8(11)14-7/h5,16H,1-4H3,(H,13,14,15) |
| InChIKey | NWWHAOUYWJTBSN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol?
The IUPAC name of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol (CID 106192316) is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol?
The canonical SMILES for 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol is CC(C)(O)C(C)(C)Nc1nc(Cl)ncc1F.
What is the InChIKey of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol?
The InChIKey is NWWHAOUYWJTBSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClFN3O/c1-9(2,10(3,4)16)15-7-6(12)5-13-8(11)14-7/h5,16H,1-4H3,(H,13,14,15).
What are the key properties of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol?
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol has a molecular weight of 247.70 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 106192316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).