C10H9Cl2N5O2S — CID 106192567
4-[[(3,6-dichloro-1,2,4-triazin-5-yl)amino]methyl]benzenesulfonamide (PubChem CID 106192567) has the molecular formula C10H9Cl2N5O2S and a molecular weight of 334.19 g/mol. Its IUPAC name is 4-[[(3,6-dichloro-1,2,4-triazin-5-yl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(3,6-dichloro-1,2,4-triazin-5-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106192567 |
| Molecular Formula | C10H9Cl2N5O2S |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 4-[[(3,6-dichloro-1,2,4-triazin-5-yl)amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2nc(Cl)nnc2Cl)cc1 |
| InChI | InChI=1S/C10H9Cl2N5O2S/c11-8-9(15-10(12)17-16-8)14-5-6-1-3-7(4-2-6)20(13,18)19/h1-4H,5H2,(H2,13,18,19)(H,14,15,17) |
| InChIKey | GPUQMQJWTCXSDT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |