C16H23NO4Se — CID 10619262
(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylselanylbutanoic acid (PubChem CID 10619262) has the molecular formula C16H23NO4Se and a molecular weight of 372.32 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylselanylbutanoic acid.
| Compound Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylselanylbutanoic acid |
|---|---|
| PubChem CID | 10619262 |
| Molecular Formula | C16H23NO4Se |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylselanylbutanoic acid |
| SMILES | CC(C[Se]c1ccccc1)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H23NO4Se/c1-11(10-22-12-8-6-5-7-9-12)13(14(18)19)17-15(20)21-16(2,3)4/h5-9,11,13H,10H2,1-4H3,(H,17,20)(H,18,19)/t11?,13-/m0/s1 |
| InChIKey | XFHGSWOJBFICIE-YUZLPWPTSA-N |
| XLogP | 2.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|