About 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile
4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile (PubChem CID 106192772) has the molecular formula C14H10F3N3
and a molecular weight of 277.25 g/mol. Its IUPAC name is 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile |
| PubChem CID | 106192772 |
| Molecular Formula | C14H10F3N3 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile |
| SMILES | CC(Nc1nc(F)c(F)cc1F)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H10F3N3/c1-8(10-4-2-9(7-18)3-5-10)19-14-12(16)6-11(15)13(17)20-14/h2-6,8H,1H3,(H,19,20) |
| InChIKey | TYJQUBIVPRMGJD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile?
The IUPAC name of 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile (CID 106192772) is 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile.
What is the SMILES notation for 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile?
The canonical SMILES for 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile is CC(Nc1nc(F)c(F)cc1F)c1ccc(C#N)cc1.
What is the InChIKey of 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile?
The InChIKey is TYJQUBIVPRMGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3/c1-8(10-4-2-9(7-18)3-5-10)19-14-12(16)6-11(15)13(17)20-14/h2-6,8H,1H3,(H,19,20).
What are the key properties of 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile?
4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile has a molecular weight of 277.25 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(3,5,6-trifluoro-2-pyridinyl)amino]ethyl]benzonitrile is sourced from PubChem (CID 106192772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).