C22H32O3Si — CID 10619312
6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-8-(6-oxocyclohexen-1-yl)octa-2,7-diynal (PubChem CID 10619312) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-8-(6-oxocyclohexen-1-yl)octa-2,7-diynal.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-8-(6-oxocyclohexen-1-yl)octa-2,7-diynal |
|---|---|
| PubChem CID | 10619312 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-8-(6-oxocyclohexen-1-yl)octa-2,7-diynal |
| SMILES | CC(C)(C#CC=O)CC(C#CC1=CCCCC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H32O3Si/c1-21(2,3)26(6,7)25-19(17-22(4,5)15-10-16-23)14-13-18-11-8-9-12-20(18)24/h11,16,19H,8-9,12,17H2,1-7H3 |
| InChIKey | AIVOMFGHAKMIPU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|