About N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide
N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 106193384) has the molecular formula C12H18BrN5O2S
and a molecular weight of 376.28 g/mol. Its IUPAC name is N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide |
| PubChem CID | 106193384 |
| Molecular Formula | C12H18BrN5O2S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNc1nc(Br)cn2ccnc12)S(C)(=O)=O |
| InChI | InChI=1S/C12H18BrN5O2S/c1-3-18(21(2,19)20)7-4-5-14-11-12-15-6-8-17(12)9-10(13)16-11/h6,8-9H,3-5,7H2,1-2H3,(H,14,16) |
| InChIKey | VQBZLCZJCWFUJE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide?
The IUPAC name of N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide (CID 106193384) is N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide.
What is the SMILES notation for N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide?
The canonical SMILES for N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide is CCN(CCCNc1nc(Br)cn2ccnc12)S(C)(=O)=O.
What is the InChIKey of N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide?
The InChIKey is VQBZLCZJCWFUJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrN5O2S/c1-3-18(21(2,19)20)7-4-5-14-11-12-15-6-8-17(12)9-10(13)16-11/h6,8-9H,3-5,7H2,1-2H3,(H,14,16).
What are the key properties of N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide?
N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide has a molecular weight of 376.28 g/mol, XLogP of 1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propyl]-N-ethylmethanesulfonamide is sourced from PubChem (CID 106193384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).