C8H8ClN5 — CID 106193468
3-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine (PubChem CID 106193468) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 3-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine.
| Compound Name | 3-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106193468 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine |
| SMILES | Clc1nccnc1NCc1cn[nH]c1 |
| InChI | InChI=1S/C8H8ClN5/c9-7-8(11-2-1-10-7)12-3-6-4-13-14-5-6/h1-2,4-5H,3H2,(H,11,12)(H,13,14) |
| InChIKey | ZSTYUQMYQNCNEN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |