C16H20ClN3 — CID 106193524
6-chloro-5-ethyl-N-[1-(4-ethylphenyl)ethyl]pyrimidin-4-amine (PubChem CID 106193524) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is 6-chloro-5-ethyl-N-[1-(4-ethylphenyl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-ethyl-N-[1-(4-ethylphenyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106193524 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 6-chloro-5-ethyl-N-[1-(4-ethylphenyl)ethyl]pyrimidin-4-amine |
| SMILES | CCc1ccc(C(C)Nc2ncnc(Cl)c2CC)cc1 |
| InChI | InChI=1S/C16H20ClN3/c1-4-12-6-8-13(9-7-12)11(3)20-16-14(5-2)15(17)18-10-19-16/h6-11H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | WSCCNZUSDKVBDI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |