C15H14BrClFN3 — CID 106193577
N-[(2-bromo-5-fluorophenyl)methyl]-6-chloro-2-cyclopropyl-5-methylpyrimidin-4-amine (PubChem CID 106193577) has the molecular formula C15H14BrClFN3 and a molecular weight of 370.65 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-6-chloro-2-cyclopropyl-5-methylpyrimidin-4-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-6-chloro-2-cyclopropyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106193577 |
| Molecular Formula | C15H14BrClFN3 |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-6-chloro-2-cyclopropyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C15H14BrClFN3/c1-8-13(17)20-15(9-2-3-9)21-14(8)19-7-10-6-11(18)4-5-12(10)16/h4-6,9H,2-3,7H2,1H3,(H,19,20,21) |
| InChIKey | IRCRFUUJLNZAJK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |