About 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine
2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 106194025) has the molecular formula C12H11Cl2N3S
and a molecular weight of 300.21 g/mol. Its IUPAC name is 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 106194025 |
| Molecular Formula | C12H11Cl2N3S |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Clc1ncc(Cl)c(NCc2cc3c(s2)CCC3)n1 |
| InChI | InChI=1S/C12H11Cl2N3S/c13-9-6-16-12(14)17-11(9)15-5-8-4-7-2-1-3-10(7)18-8/h4,6H,1-3,5H2,(H,15,16,17) |
| InChIKey | WGBDKRFVXBZGNS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine (CID 106194025) is 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine is Clc1ncc(Cl)c(NCc2cc3c(s2)CCC3)n1.
What is the InChIKey of 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
The InChIKey is WGBDKRFVXBZGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N3S/c13-9-6-16-12(14)17-11(9)15-5-8-4-7-2-1-3-10(7)18-8/h4,6H,1-3,5H2,(H,15,16,17).
What are the key properties of 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine has a molecular weight of 300.21 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 106194025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).